C11H9ClN2O7 — CID 78910208
2-[(4-chloro-2-nitrobenzoyl)amino]butanedioic acid (PubChem CID 78910208) has the molecular formula C11H9ClN2O7 and a molecular weight of 316.65 g/mol. Its IUPAC name is 2-[(4-chloro-2-nitrobenzoyl)amino]butanedioic acid.
| Compound Name | 2-[(4-chloro-2-nitrobenzoyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 78910208 |
| Molecular Formula | C11H9ClN2O7 |
| Molecular Weight | 316.65 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-[(4-chloro-2-nitrobenzoyl)amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(Cl)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H9ClN2O7/c12-5-1-2-6(8(3-5)14(20)21)10(17)13-7(11(18)19)4-9(15)16/h1-3,7H,4H2,(H,13,17)(H,15,16)(H,18,19) |
| InChIKey | QPHPMYFEXUHCTD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.65 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|