C12H17N3O4 — CID 62045431
N-hexan-3-yl-2,4-dinitroaniline (PubChem CID 62045431) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is N-hexan-3-yl-2,4-dinitroaniline.
| Compound Name | N-hexan-3-yl-2,4-dinitroaniline |
|---|---|
| PubChem CID | 62045431 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-hexan-3-yl-2,4-dinitroaniline |
| SMILES | CCCC(CC)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O4/c1-3-5-9(4-2)13-11-7-6-10(14(16)17)8-12(11)15(18)19/h6-9,13H,3-5H2,1-2H3 |
| InChIKey | FVRIRZHFRBIUPQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|