C10H10N2O8S — CID 66222005
2-[(2,4-dinitrophenyl)methylsulfonyl]propanoic acid (PubChem CID 66222005) has the molecular formula C10H10N2O8S and a molecular weight of 318.26 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenyl)methylsulfonyl]propanoic acid.
| Compound Name | 2-[(2,4-dinitrophenyl)methylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 66222005 |
| Molecular Formula | C10H10N2O8S |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-[(2,4-dinitrophenyl)methylsulfonyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O8S/c1-6(10(13)14)21(19,20)5-7-2-3-8(11(15)16)4-9(7)12(17)18/h2-4,6H,5H2,1H3,(H,13,14) |
| InChIKey | DXMYFWCXUIZKPW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|