About 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride
1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride (PubChem CID 160906769) has the molecular formula C15H15ClN2O6S
and a molecular weight of 386.81 g/mol. Its IUPAC name is 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride.
Molecular Properties
| Compound Name | 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride |
| PubChem CID | 160906769 |
| Molecular Formula | C15H15ClN2O6S |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride |
| SMILES | CCc1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1CS(=O)(=O)Cl |
| InChI | InChI=1S/C8H9NO2.C7H6ClNO4S/c1-2-7-5-3-4-6-8(7)9(10)11;8-14(12,13)5-6-3-1-2-4-7(6)9(10)11/h3-6H,2H2,1H3;1-4H,5H2 |
| InChIKey | SQGCGSQXAZRNOL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride?
The IUPAC name of 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride (CID 160906769) is 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride.
What is the SMILES notation for 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride?
The canonical SMILES for 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride is CCc1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1CS(=O)(=O)Cl.
What is the InChIKey of 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride?
The InChIKey is SQGCGSQXAZRNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C7H6ClNO4S/c1-2-7-5-3-4-6-8(7)9(10)11;8-14(12,13)5-6-3-1-2-4-7(6)9(10)11/h3-6H,2H2,1H3;1-4H,5H2.
What are the key properties of 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride?
1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride has a molecular weight of 386.81 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-nitrobenzene;(2-nitrophenyl)methanesulfonyl chloride is sourced from PubChem (CID 160906769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).