2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid

C9H8N2O7S — CID 66222017

IUPAC2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid
SMILESO=C(O)CS(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C9H8N2O7S/c12-9(13)5-19(18)4-6-1-2-7(10(14)15)3-8(6)11(16)17/h1-3H,4-5H2,(H,12,13)
InChIKeyQVAZMTHOSKCZII-UHFFFAOYSA-N
MW288.24 g/mol
LogP0.84
Rot. Bonds6

About 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid

2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid (PubChem CID 66222017) has the molecular formula C9H8N2O7S and a molecular weight of 288.24 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid.

Molecular Properties

Compound Name2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid
PubChem CID66222017
Molecular FormulaC9H8N2O7S
Molecular Weight288.24 g/mol
Exact Mass288.01
IUPAC Name2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid
SMILESO=C(O)CS(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C9H8N2O7S/c12-9(13)5-19(18)4-6-1-2-7(10(14)15)3-8(6)11(16)17/h1-3H,4-5H2,(H,12,13)
InChIKeyQVAZMTHOSKCZII-UHFFFAOYSA-N
XLogP0.84
TPSA140.65 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.24
LogP ≤ 50.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid?
The IUPAC name of 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid (CID 66222017) is 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid.
What is the SMILES notation for 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid?
The canonical SMILES for 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid is O=C(O)CS(=O)Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid?
The InChIKey is QVAZMTHOSKCZII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O7S/c12-9(13)5-19(18)4-6-1-2-7(10(14)15)3-8(6)11(16)17/h1-3H,4-5H2,(H,12,13).
What are the key properties of 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid?
2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid has a molecular weight of 288.24 g/mol, XLogP of 0.84, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dinitrophenyl)methylsulfinyl]acetic acid is sourced from PubChem (CID 66222017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).