C21H27GdN5O14+3 — CID 10372757
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[(2,4-dinitrophenyl)methoxy]-2-oxoethyl]amino]ethyl]amino]acetic acid;gadolinium(3+) (PubChem CID 10372757) has the molecular formula C21H27GdN5O14+3 and a molecular weight of 730.72 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[(2,4-dinitrophenyl)methoxy]-2-oxoethyl]amino]ethyl]amino]acetic acid;gadolinium(3+).
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[(2,4-dinitrophenyl)methoxy]-2-oxoethyl]amino]ethyl]amino]acetic acid;gadolinium(3+) |
|---|---|
| PubChem CID | 10372757 |
| Molecular Formula | C21H27GdN5O14+3 |
| Molecular Weight | 730.72 g/mol |
| Exact Mass | 731.08 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-[(2,4-dinitrophenyl)methoxy]-2-oxoethyl]amino]ethyl]amino]acetic acid;gadolinium(3+) |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)OCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].[Gd+3] |
| InChI | InChI=1S/C21H27N5O14.Gd/c27-17(28)8-22(3-5-23(9-18(29)30)10-19(31)32)4-6-24(11-20(33)34)12-21(35)40-13-14-1-2-15(25(36)37)7-16(14)26(38)39;/h1-2,7H,3-6,8-13H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34);/q;+3 |
| InChIKey | IVRGYUAYXIVHFQ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 271.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.72 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|