C18H15N3O8 — CID 159395188
2-(2,4-dinitrophenyl)ethanol;1-(4-hydroxyphenyl)pyrrole-2,5-dione (PubChem CID 159395188) has the molecular formula C18H15N3O8 and a molecular weight of 401.33 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)ethanol;1-(4-hydroxyphenyl)pyrrole-2,5-dione.
| Compound Name | 2-(2,4-dinitrophenyl)ethanol;1-(4-hydroxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159395188 |
| Molecular Formula | C18H15N3O8 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2-(2,4-dinitrophenyl)ethanol;1-(4-hydroxyphenyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(O)cc1.O=[N+]([O-])c1ccc(CCO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7NO3.C8H8N2O5/c12-8-3-1-7(2-4-8)11-9(13)5-6-10(11)14;11-4-3-6-1-2-7(9(12)13)5-8(6)10(14)15/h1-6,12H;1-2,5,11H,3-4H2 |
| InChIKey | LMPSLJFEWNDHJP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|