C14H7N3O6 — CID 70397403
1-[4-(2,5-dioxopyrrol-1-yl)-3-nitrophenyl]pyrrole-2,5-dione (PubChem CID 70397403) has the molecular formula C14H7N3O6 and a molecular weight of 313.23 g/mol. Its IUPAC name is 1-[4-(2,5-dioxopyrrol-1-yl)-3-nitrophenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-(2,5-dioxopyrrol-1-yl)-3-nitrophenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70397403 |
| Molecular Formula | C14H7N3O6 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 1-[4-(2,5-dioxopyrrol-1-yl)-3-nitrophenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(N2C(=O)C=CC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H7N3O6/c18-11-3-4-12(19)15(11)8-1-2-9(10(7-8)17(22)23)16-13(20)5-6-14(16)21/h1-7H |
| InChIKey | ASCYUBUZECHYAJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|