C20H17N3O6 — CID 139617790
3,5-dinitro-2-[2-(4-phenylmethoxyphenyl)ethoxy]pyridine (PubChem CID 139617790) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is 3,5-dinitro-2-[2-(4-phenylmethoxyphenyl)ethoxy]pyridine.
| Compound Name | 3,5-dinitro-2-[2-(4-phenylmethoxyphenyl)ethoxy]pyridine |
|---|---|
| PubChem CID | 139617790 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3,5-dinitro-2-[2-(4-phenylmethoxyphenyl)ethoxy]pyridine |
| SMILES | O=[N+]([O-])c1cnc(OCCc2ccc(OCc3ccccc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17N3O6/c24-22(25)17-12-19(23(26)27)20(21-13-17)28-11-10-15-6-8-18(9-7-15)29-14-16-4-2-1-3-5-16/h1-9,12-13H,10-11,14H2 |
| InChIKey | BYUXBGRIPSPSQJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 117.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|