C20H18N4O7 — CID 2749383
[2-(2-phenylethyl)phenyl]azanium;2,4,6-trinitrophenolate (PubChem CID 2749383) has the molecular formula C20H18N4O7 and a molecular weight of 426.39 g/mol. Its IUPAC name is [2-(2-phenylethyl)phenyl]azanium;2,4,6-trinitrophenolate.
| Compound Name | [2-(2-phenylethyl)phenyl]azanium;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 2749383 |
| Molecular Formula | C20H18N4O7 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [2-(2-phenylethyl)phenyl]azanium;2,4,6-trinitrophenolate |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.[NH3+]c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C14H15N.C6H3N3O7/c15-14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-9H,10-11,15H2;1-2,10H |
| InChIKey | PTWLTIGSULMPTD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 180.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|