nitric acid;1,1,2-trimethyl-2-phenylhydrazine

C9H15N3O3 — CID 172683859

IUPACnitric acid;1,1,2-trimethyl-2-phenylhydrazine
SMILESCN(C)N(C)c1ccccc1.O=[N+]([O-])O
InChIInChI=1S/C9H14N2.HNO3/c1-10(2)11(3)9-7-5-4-6-8-9;2-1(3)4/h4-8H,1-3H3;(H,2,3,4)
InChIKeyATPWIWSSAZNROO-UHFFFAOYSA-N
MW213.24 g/mol
LogP1.25
Rot. Bonds2

About nitric acid;1,1,2-trimethyl-2-phenylhydrazine

nitric acid;1,1,2-trimethyl-2-phenylhydrazine (PubChem CID 172683859) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is nitric acid;1,1,2-trimethyl-2-phenylhydrazine.

Molecular Properties

Compound Namenitric acid;1,1,2-trimethyl-2-phenylhydrazine
PubChem CID172683859
Molecular FormulaC9H15N3O3
Molecular Weight213.24 g/mol
Exact Mass213.11
IUPAC Namenitric acid;1,1,2-trimethyl-2-phenylhydrazine
SMILESCN(C)N(C)c1ccccc1.O=[N+]([O-])O
InChIInChI=1S/C9H14N2.HNO3/c1-10(2)11(3)9-7-5-4-6-8-9;2-1(3)4/h4-8H,1-3H3;(H,2,3,4)
InChIKeyATPWIWSSAZNROO-UHFFFAOYSA-N
XLogP1.25
TPSA69.85 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.24
LogP ≤ 51.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze nitric acid;1,1,2-trimethyl-2-phenylhydrazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of nitric acid;1,1,2-trimethyl-2-phenylhydrazine?
The IUPAC name of nitric acid;1,1,2-trimethyl-2-phenylhydrazine (CID 172683859) is nitric acid;1,1,2-trimethyl-2-phenylhydrazine.
What is the SMILES notation for nitric acid;1,1,2-trimethyl-2-phenylhydrazine?
The canonical SMILES for nitric acid;1,1,2-trimethyl-2-phenylhydrazine is CN(C)N(C)c1ccccc1.O=[N+]([O-])O.
What is the InChIKey of nitric acid;1,1,2-trimethyl-2-phenylhydrazine?
The InChIKey is ATPWIWSSAZNROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.HNO3/c1-10(2)11(3)9-7-5-4-6-8-9;2-1(3)4/h4-8H,1-3H3;(H,2,3,4).
What are the key properties of nitric acid;1,1,2-trimethyl-2-phenylhydrazine?
nitric acid;1,1,2-trimethyl-2-phenylhydrazine has a molecular weight of 213.24 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitric acid;1,1,2-trimethyl-2-phenylhydrazine is sourced from PubChem (CID 172683859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).