C15H21NO5 — CID 70686302
N,N-dimethyl-2-[(E)-3-phenylprop-2-enoxy]ethanamine;oxalic acid (PubChem CID 70686302) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is N,N-dimethyl-2-[(E)-3-phenylprop-2-enoxy]ethanamine;oxalic acid.
| Compound Name | N,N-dimethyl-2-[(E)-3-phenylprop-2-enoxy]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 70686302 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N,N-dimethyl-2-[(E)-3-phenylprop-2-enoxy]ethanamine;oxalic acid |
| SMILES | CN(C)CCOC/C=C/c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19NO.C2H2O4/c1-14(2)10-12-15-11-6-9-13-7-4-3-5-8-13;3-1(4)2(5)6/h3-9H,10-12H2,1-2H3;(H,3,4)(H,5,6)/b9-6+; |
| InChIKey | JDDHLXSTCZKJNV-MLBSPLJJSA-N |
| XLogP | 1.43 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|