C15H23NO — CID 70406914
N,N-dimethyl-4-(3-phenylprop-2-enoxy)butan-1-amine (PubChem CID 70406914) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-phenylprop-2-enoxy)butan-1-amine.
| Compound Name | N,N-dimethyl-4-(3-phenylprop-2-enoxy)butan-1-amine |
|---|---|
| PubChem CID | 70406914 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N,N-dimethyl-4-(3-phenylprop-2-enoxy)butan-1-amine |
| SMILES | CN(C)CCCCOCC=Cc1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-16(2)12-6-7-13-17-14-8-11-15-9-4-3-5-10-15/h3-5,8-11H,6-7,12-14H2,1-2H3 |
| InChIKey | ULYMQEQTNPDBHB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|