C18H30N2O5 — CID 67634798
N'-[2-(2-methoxyphenyl)ethyl]-N'-methylhexane-1,6-diamine;oxalic acid (PubChem CID 67634798) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is N'-[2-(2-methoxyphenyl)ethyl]-N'-methylhexane-1,6-diamine;oxalic acid.
| Compound Name | N'-[2-(2-methoxyphenyl)ethyl]-N'-methylhexane-1,6-diamine;oxalic acid |
|---|---|
| PubChem CID | 67634798 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | N'-[2-(2-methoxyphenyl)ethyl]-N'-methylhexane-1,6-diamine;oxalic acid |
| SMILES | COc1ccccc1CCN(C)CCCCCCN.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H28N2O.C2H2O4/c1-18(13-8-4-3-7-12-17)14-11-15-9-5-6-10-16(15)19-2;3-1(4)2(5)6/h5-6,9-10H,3-4,7-8,11-14,17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XGOQVUKJPGHQJW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|