C19H25N4O2+ — CID 5211916
1-(4-methylphenyl)-3-(2-morpholin-4-ium-4-yl-2-pyridin-3-ylethyl)urea (PubChem CID 5211916) has the molecular formula C19H25N4O2+ and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(2-morpholin-4-ium-4-yl-2-pyridin-3-ylethyl)urea.
| Compound Name | 1-(4-methylphenyl)-3-(2-morpholin-4-ium-4-yl-2-pyridin-3-ylethyl)urea |
|---|---|
| PubChem CID | 5211916 |
| Molecular Formula | C19H25N4O2+ |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-(4-methylphenyl)-3-(2-morpholin-4-ium-4-yl-2-pyridin-3-ylethyl)urea |
| SMILES | Cc1ccc(NC(=O)NCC(c2cccnc2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C19H24N4O2/c1-15-4-6-17(7-5-15)22-19(24)21-14-18(16-3-2-8-20-13-16)23-9-11-25-12-10-23/h2-8,13,18H,9-12,14H2,1H3,(H2,21,22,24)/p+1 |
| InChIKey | FMNIJGVCDVHQPV-UHFFFAOYSA-O |
| XLogP | 1.17 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |