C18H23N4O2+ — CID 5211914
1-(2-morpholin-4-ium-4-yl-2-pyridin-3-ylethyl)-3-phenylurea (PubChem CID 5211914) has the molecular formula C18H23N4O2+ and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(2-morpholin-4-ium-4-yl-2-pyridin-3-ylethyl)-3-phenylurea.
| Compound Name | 1-(2-morpholin-4-ium-4-yl-2-pyridin-3-ylethyl)-3-phenylurea |
|---|---|
| PubChem CID | 5211914 |
| Molecular Formula | C18H23N4O2+ |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-(2-morpholin-4-ium-4-yl-2-pyridin-3-ylethyl)-3-phenylurea |
| SMILES | O=C(NCC(c1cccnc1)[NH+]1CCOCC1)Nc1ccccc1 |
| InChI | InChI=1S/C18H22N4O2/c23-18(21-16-6-2-1-3-7-16)20-14-17(15-5-4-8-19-13-15)22-9-11-24-12-10-22/h1-8,13,17H,9-12,14H2,(H2,20,21,23)/p+1 |
| InChIKey | SCOYYLUSVCRBQZ-UHFFFAOYSA-O |
| XLogP | 0.86 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |