C21H18O8 — CID 7569479
[6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate (PubChem CID 7569479) has the molecular formula C21H18O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate.
| Compound Name | [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate |
|---|---|
| PubChem CID | 7569479 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate |
| SMILES | COc1ccc([C@H](c2cc3c(cc2OC(C)=O)OCO3)[C@@H]2C(=O)COC2=O)cc1 |
| InChI | InChI=1S/C21H18O8/c1-11(22)29-16-8-18-17(27-10-28-18)7-14(16)19(20-15(23)9-26-21(20)24)12-3-5-13(25-2)6-4-12/h3-8,19-20H,9-10H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | SIBMPGNTKPNQPE-UXHICEINSA-N |
| XLogP | 2.22 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|