About [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate
[6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate (PubChem CID 7569479) has the molecular formula C21H18O8
and a molecular weight of 398.37 g/mol. Its IUPAC name is [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate.
Molecular Properties
| Compound Name | [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate |
| PubChem CID | 7569479 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate |
| SMILES | COc1ccc([C@H](c2cc3c(cc2OC(C)=O)OCO3)[C@@H]2C(=O)COC2=O)cc1 |
| InChI | InChI=1S/C21H18O8/c1-11(22)29-16-8-18-17(27-10-28-18)7-14(16)19(20-15(23)9-26-21(20)24)12-3-5-13(25-2)6-4-12/h3-8,19-20H,9-10H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | SIBMPGNTKPNQPE-UXHICEINSA-N |
| XLogP | 2.22 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate?
The IUPAC name of [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate (CID 7569479) is [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate.
What is the SMILES notation for [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate?
The canonical SMILES for [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate is COc1ccc([C@H](c2cc3c(cc2OC(C)=O)OCO3)[C@@H]2C(=O)COC2=O)cc1.
What is the InChIKey of [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate?
The InChIKey is SIBMPGNTKPNQPE-UXHICEINSA-N. The full InChI is InChI=1S/C21H18O8/c1-11(22)29-16-8-18-17(27-10-28-18)7-14(16)19(20-15(23)9-26-21(20)24)12-3-5-13(25-2)6-4-12/h3-8,19-20H,9-10H2,1-2H3/t19-,20+/m1/s1.
What are the key properties of [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate?
[6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate has a molecular weight of 398.37 g/mol, XLogP of 2.22, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(R)-[(3R)-2,4-dioxooxolan-3-yl]-(4-methoxyphenyl)methyl]-1,3-benzodioxol-5-yl] acetate is sourced from PubChem (CID 7569479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).