C24H24O11 — CID 54685993
4-acetyloxy-2-[(6-acetyloxy-1,3-benzodioxol-5-yl)-(2,4-dimethoxyphenyl)methyl]-3-hydroxybut-2-enoic acid (PubChem CID 54685993) has the molecular formula C24H24O11 and a molecular weight of 488.45 g/mol. Its IUPAC name is 4-acetyloxy-2-[(6-acetyloxy-1,3-benzodioxol-5-yl)-(2,4-dimethoxyphenyl)methyl]-3-hydroxybut-2-enoic acid.
| Compound Name | 4-acetyloxy-2-[(6-acetyloxy-1,3-benzodioxol-5-yl)-(2,4-dimethoxyphenyl)methyl]-3-hydroxybut-2-enoic acid |
|---|---|
| PubChem CID | 54685993 |
| Molecular Formula | C24H24O11 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 4-acetyloxy-2-[(6-acetyloxy-1,3-benzodioxol-5-yl)-(2,4-dimethoxyphenyl)methyl]-3-hydroxybut-2-enoic acid |
| SMILES | COc1ccc(C(C(C(=O)O)=C(O)COC(C)=O)c2cc3c(cc2OC(C)=O)OCO3)c(OC)c1 |
| InChI | InChI=1S/C24H24O11/c1-12(25)32-10-17(27)23(24(28)29)22(15-6-5-14(30-3)7-18(15)31-4)16-8-20-21(34-11-33-20)9-19(16)35-13(2)26/h5-9,22,27H,10-11H2,1-4H3,(H,28,29) |
| InChIKey | SIJOWAKPASHFKR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|