C16H20N2OS — CID 115426261
3-amino-2,2-dimethyl-N-[phenyl(thiophen-2-yl)methyl]propanamide (PubChem CID 115426261) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-N-[phenyl(thiophen-2-yl)methyl]propanamide.
| Compound Name | 3-amino-2,2-dimethyl-N-[phenyl(thiophen-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 115426261 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3-amino-2,2-dimethyl-N-[phenyl(thiophen-2-yl)methyl]propanamide |
| SMILES | CC(C)(CN)C(=O)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C16H20N2OS/c1-16(2,11-17)15(19)18-14(13-9-6-10-20-13)12-7-4-3-5-8-12/h3-10,14H,11,17H2,1-2H3,(H,18,19) |
| InChIKey | COIGPMOUNNGNHA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |