C13H20N2O — CID 115426736
3-amino-2,2-dimethyl-N-[(1S)-1-phenylethyl]propanamide (PubChem CID 115426736) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-N-[(1S)-1-phenylethyl]propanamide.
| Compound Name | 3-amino-2,2-dimethyl-N-[(1S)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 115426736 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-amino-2,2-dimethyl-N-[(1S)-1-phenylethyl]propanamide |
| SMILES | C[C@H](NC(=O)C(C)(C)CN)c1ccccc1 |
| InChI | InChI=1S/C13H20N2O/c1-10(11-7-5-4-6-8-11)15-12(16)13(2,3)9-14/h4-8,10H,9,14H2,1-3H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | CNKMTVARWJWVFE-JTQLQIEISA-N |
| XLogP | 1.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |