C24H30ClN7O6 — CID 10076179
N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[2-(1-methyl-4-nitropyrrol-2-yl)-2-oxoacetyl]pyrrole-2-carboxamide;hydrochloride (PubChem CID 10076179) has the molecular formula C24H30ClN7O6 and a molecular weight of 548.00 g/mol. Its IUPAC name is N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[2-(1-methyl-4-nitropyrrol-2-yl)-2-oxoacetyl]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[2-(1-methyl-4-nitropyrrol-2-yl)-2-oxoacetyl]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 10076179 |
| Molecular Formula | C24H30ClN7O6 |
| Molecular Weight | 548.00 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[2-(1-methyl-4-nitropyrrol-2-yl)-2-oxoacetyl]pyrrole-2-carboxamide;hydrochloride |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(C(=O)C(=O)c3cc([N+](=O)[O-])cn3C)cn2C)cn1C.Cl |
| InChI | InChI=1S/C24H29N7O6.ClH/c1-27(2)8-6-7-25-23(34)20-10-16(13-29(20)4)26-24(35)19-9-15(12-28(19)3)21(32)22(33)18-11-17(31(36)37)14-30(18)5;/h9-14H,6-8H2,1-5H3,(H,25,34)(H,26,35);1H |
| InChIKey | QDULDXWRDYRUDU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 153.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.00 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|