C20H30ClN7O3 — CID 88651473
4-[[4-(aziridine-1-carbonylamino)-1-methylpyrrole-2-carbonyl]amino]-N-[3-(dimethylamino)propyl]-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 88651473) has the molecular formula C20H30ClN7O3 and a molecular weight of 451.96 g/mol. Its IUPAC name is 4-[[4-(aziridine-1-carbonylamino)-1-methylpyrrole-2-carbonyl]amino]-N-[3-(dimethylamino)propyl]-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-[[4-(aziridine-1-carbonylamino)-1-methylpyrrole-2-carbonyl]amino]-N-[3-(dimethylamino)propyl]-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 88651473 |
| Molecular Formula | C20H30ClN7O3 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 4-[[4-(aziridine-1-carbonylamino)-1-methylpyrrole-2-carbonyl]amino]-N-[3-(dimethylamino)propyl]-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)N3CC3)cn2C)cn1C.Cl |
| InChI | InChI=1S/C20H29N7O3.ClH/c1-24(2)7-5-6-21-18(28)16-10-14(12-25(16)3)22-19(29)17-11-15(13-26(17)4)23-20(30)27-8-9-27;/h10-13H,5-9H2,1-4H3,(H,21,28)(H,22,29)(H,23,30);1H |
| InChIKey | REKFPITVQOOPAC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|