C24H29IN6O3 — CID 100931012
N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-4-[(3-iodobenzoyl)amino]-1-methylpyrrole-2-carboxamide (PubChem CID 100931012) has the molecular formula C24H29IN6O3 and a molecular weight of 576.44 g/mol. Its IUPAC name is N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-4-[(3-iodobenzoyl)amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-4-[(3-iodobenzoyl)amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 100931012 |
| Molecular Formula | C24H29IN6O3 |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-4-[(3-iodobenzoyl)amino]-1-methylpyrrole-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cccc(I)c3)cn2C)cn1C |
| InChI | InChI=1S/C24H29IN6O3/c1-29(2)10-6-9-26-23(33)20-12-19(15-30(20)3)28-24(34)21-13-18(14-31(21)4)27-22(32)16-7-5-8-17(25)11-16/h5,7-8,11-15H,6,9-10H2,1-4H3,(H,26,33)(H,27,32)(H,28,34) |
| InChIKey | VHJHSCQIQCYWIS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|