C20H28N6O4 — CID 21296202
N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-(oxirane-2-carbonylamino)pyrrole-2-carboxamide (PubChem CID 21296202) has the molecular formula C20H28N6O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-(oxirane-2-carbonylamino)pyrrole-2-carboxamide.
| Compound Name | N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-(oxirane-2-carbonylamino)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 21296202 |
| Molecular Formula | C20H28N6O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-(oxirane-2-carbonylamino)pyrrole-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)C3CO3)cn2C)cn1C |
| InChI | InChI=1S/C20H28N6O4/c1-24(2)7-5-6-21-18(27)15-8-13(10-25(15)3)22-19(28)16-9-14(11-26(16)4)23-20(29)17-12-30-17/h8-11,17H,5-7,12H2,1-4H3,(H,21,27)(H,22,28)(H,23,29) |
| InChIKey | KNYDTADMIBMGIV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|