C49H56N12O7 — CID 101065005
3-N,6-N-bis[5-[[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-9-oxofluorene-3,6-dicarboxamide (PubChem CID 101065005) has the molecular formula C49H56N12O7 and a molecular weight of 925.06 g/mol. Its IUPAC name is 3-N,6-N-bis[5-[[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-9-oxofluorene-3,6-dicarboxamide.
| Compound Name | 3-N,6-N-bis[5-[[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-9-oxofluorene-3,6-dicarboxamide |
|---|---|
| PubChem CID | 101065005 |
| Molecular Formula | C49H56N12O7 |
| Molecular Weight | 925.06 g/mol |
| Exact Mass | 924.44 |
| IUPAC Name | 3-N,6-N-bis[5-[[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-9-oxofluorene-3,6-dicarboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3ccc4c(c3)-c3cc(C(=O)Nc5cc(C(=O)Nc6cc(C(=O)NCCCN(C)C)n(C)c6)n(C)c5)ccc3C4=O)cn2C)cn1C |
| InChI | InChI=1S/C49H56N12O7/c1-56(2)17-9-15-50-46(65)39-21-33(27-58(39)5)54-48(67)41-23-31(25-60(41)7)52-44(63)29-11-13-35-37(19-29)38-20-30(12-14-36(38)43(35)62)45(64)53-32-24-42(61(8)26-32)49(68)55-34-22-40(59(6)28-34)47(66)51-16-10-18-57(3)4/h11-14,19-28H,9-10,15-18H2,1-8H3,(H,50,65)(H,51,66)(H,52,63)(H,53,64)(H,54,67)(H,55,68) |
| InChIKey | RCDDGGKCSCSPMF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 217.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.06 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|