C34H37N7O7S — CID 16736082
N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-4-[3-[(9,10-dioxoanthracen-2-yl)sulfonylamino]propanoylamino]-1-methylpyrrole-2-carboxamide (PubChem CID 16736082) has the molecular formula C34H37N7O7S and a molecular weight of 687.78 g/mol. Its IUPAC name is N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-4-[3-[(9,10-dioxoanthracen-2-yl)sulfonylamino]propanoylamino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-4-[3-[(9,10-dioxoanthracen-2-yl)sulfonylamino]propanoylamino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 16736082 |
| Molecular Formula | C34H37N7O7S |
| Molecular Weight | 687.78 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | N-[5-[3-(dimethylamino)propylcarbamoyl]-1-methylpyrrol-3-yl]-4-[3-[(9,10-dioxoanthracen-2-yl)sulfonylamino]propanoylamino]-1-methylpyrrole-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)CCNS(=O)(=O)c3ccc4c(c3)C(=O)c3ccccc3C4=O)cn2C)cn1C |
| InChI | InChI=1S/C34H37N7O7S/c1-39(2)15-7-13-35-33(45)28-17-22(20-40(28)3)38-34(46)29-16-21(19-41(29)4)37-30(42)12-14-36-49(47,48)23-10-11-26-27(18-23)32(44)25-9-6-5-8-24(25)31(26)43/h5-6,8-11,16-20,36H,7,12-15H2,1-4H3,(H,35,45)(H,37,42)(H,38,46) |
| InChIKey | NNRTVTLMTRVYJR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 180.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.78 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|