C13H21N3O4 — CID 107318729
N-(5-hydroxypentyl)-4-nitro-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 107318729) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-4-nitro-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-4-nitro-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107318729 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-(5-hydroxypentyl)-4-nitro-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc([N+](=O)[O-])cc1C(=O)NCCCCCO |
| InChI | InChI=1S/C13H21N3O4/c1-10(2)15-9-11(16(19)20)8-12(15)13(18)14-6-4-3-5-7-17/h8-10,17H,3-7H2,1-2H3,(H,14,18) |
| InChIKey | VHYVGCJLDJWNBI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|