C18H19N7O6 — CID 170108124
methyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]imidazole-2-carbonyl]amino]pyrrole-2-carboxylate (PubChem CID 170108124) has the molecular formula C18H19N7O6 and a molecular weight of 429.39 g/mol. Its IUPAC name is methyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]imidazole-2-carbonyl]amino]pyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]imidazole-2-carbonyl]amino]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 170108124 |
| Molecular Formula | C18H19N7O6 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | methyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]imidazole-2-carbonyl]amino]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2nc(NC(=O)c3cc([N+](=O)[O-])cn3C)cn2C)cn1C |
| InChI | InChI=1S/C18H19N7O6/c1-22-7-10(5-13(22)18(28)31-4)19-17(27)15-20-14(9-24(15)3)21-16(26)12-6-11(25(29)30)8-23(12)2/h5-9H,1-4H3,(H,19,27)(H,21,26) |
| InChIKey | VSWXCCLDONGHMB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|