C18H20N8O6 — CID 46853533
ethyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]imidazole-2-carbonyl]amino]imidazole-2-carboxylate (PubChem CID 46853533) has the molecular formula C18H20N8O6 and a molecular weight of 444.41 g/mol. Its IUPAC name is ethyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]imidazole-2-carbonyl]amino]imidazole-2-carboxylate.
| Compound Name | ethyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]imidazole-2-carbonyl]amino]imidazole-2-carboxylate |
|---|---|
| PubChem CID | 46853533 |
| Molecular Formula | C18H20N8O6 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]imidazole-2-carbonyl]amino]imidazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(NC(=O)c2nc(NC(=O)c3cc([N+](=O)[O-])cn3C)cn2C)cn1C |
| InChI | InChI=1S/C18H20N8O6/c1-5-32-18(29)15-20-13(9-25(15)4)22-17(28)14-19-12(8-24(14)3)21-16(27)11-6-10(26(30)31)7-23(11)2/h6-9H,5H2,1-4H3,(H,21,27)(H,22,28) |
| InChIKey | VUWADHCQVWWPTJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|