C17H21N3O2S3 — CID 19075566
1-(3-methylthiophen-2-yl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea (PubChem CID 19075566) has the molecular formula C17H21N3O2S3 and a molecular weight of 395.58 g/mol. Its IUPAC name is 1-(3-methylthiophen-2-yl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(3-methylthiophen-2-yl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 19075566 |
| Molecular Formula | C17H21N3O2S3 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-(3-methylthiophen-2-yl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea |
| SMILES | Cc1ccsc1NC(=S)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H21N3O2S3/c1-13-9-12-24-16(13)19-17(23)18-14-5-7-15(8-6-14)25(21,22)20-10-3-2-4-11-20/h5-9,12H,2-4,10-11H2,1H3,(H2,18,19,23) |
| InChIKey | RIMYTDMLZDELOI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|