C19H24ClN3O4S4 — CID 19075577
1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea (PubChem CID 19075577) has the molecular formula C19H24ClN3O4S4 and a molecular weight of 522.14 g/mol. Its IUPAC name is 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 19075577 |
| Molecular Formula | C19H24ClN3O4S4 |
| Molecular Weight | 522.14 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(4-piperidin-1-ylsulfonylphenyl)thiourea |
| SMILES | CC(C)S(=O)(=O)c1csc(NC(=S)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c1Cl |
| InChI | InChI=1S/C19H24ClN3O4S4/c1-13(2)30(24,25)16-12-29-18(17(16)20)22-19(28)21-14-6-8-15(9-7-14)31(26,27)23-10-4-3-5-11-23/h6-9,12-13H,3-5,10-11H2,1-2H3,(H2,21,22,28) |
| InChIKey | ZFIFKVBCAYJBSC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.14 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|