C19H18BrClN4O2S2 — CID 19676891
methyl 2-[[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]carbamothioylamino]-5-ethylthiophene-3-carboxylate (PubChem CID 19676891) has the molecular formula C19H18BrClN4O2S2 and a molecular weight of 513.87 g/mol. Its IUPAC name is methyl 2-[[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]carbamothioylamino]-5-ethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]carbamothioylamino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19676891 |
| Molecular Formula | C19H18BrClN4O2S2 |
| Molecular Weight | 513.87 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | methyl 2-[[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]carbamothioylamino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)Nc2nn(Cc3ccc(Cl)cc3)cc2Br)s1 |
| InChI | InChI=1S/C19H18BrClN4O2S2/c1-3-13-8-14(18(26)27-2)17(29-13)23-19(28)22-16-15(20)10-25(24-16)9-11-4-6-12(21)7-5-11/h4-8,10H,3,9H2,1-2H3,(H2,22,23,24,28) |
| InChIKey | HWNMVFYLDZYMTI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.87 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|