C19H18BrClN4S — CID 19393342
1-[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-(4-ethylphenyl)thiourea (PubChem CID 19393342) has the molecular formula C19H18BrClN4S and a molecular weight of 449.81 g/mol. Its IUPAC name is 1-[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 19393342 |
| Molecular Formula | C19H18BrClN4S |
| Molecular Weight | 449.81 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 1-[4-bromo-1-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-(4-ethylphenyl)thiourea |
| SMILES | CCc1ccc(NC(=S)Nc2nn(Cc3ccc(Cl)cc3)cc2Br)cc1 |
| InChI | InChI=1S/C19H18BrClN4S/c1-2-13-5-9-16(10-6-13)22-19(26)23-18-17(20)12-25(24-18)11-14-3-7-15(21)8-4-14/h3-10,12H,2,11H2,1H3,(H2,22,23,24,26) |
| InChIKey | ILKCKIROCPFORW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.81 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|