C17H11BrCl4N4S — CID 19399092
1-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3,4-dichlorophenyl)thiourea (PubChem CID 19399092) has the molecular formula C17H11BrCl4N4S and a molecular weight of 525.09 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 19399092 |
| Molecular Formula | C17H11BrCl4N4S |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 521.86 |
| IUPAC Name | 1-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3,4-dichlorophenyl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)Nc1nn(Cc2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C17H11BrCl4N4S/c18-12-8-26(7-9-1-2-10(19)5-14(9)21)25-16(12)24-17(27)23-11-3-4-13(20)15(22)6-11/h1-6,8H,7H2,(H2,23,24,25,27) |
| InChIKey | MKFNDKMXFDEQJL-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|