C17H12BrCl2N5O2S — CID 19397460
1-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-nitrophenyl)thiourea (PubChem CID 19397460) has the molecular formula C17H12BrCl2N5O2S and a molecular weight of 501.19 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 19397460 |
| Molecular Formula | C17H12BrCl2N5O2S |
| Molecular Weight | 501.19 g/mol |
| Exact Mass | 498.93 |
| IUPAC Name | 1-[4-bromo-1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(4-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)Nc2nn(Cc3ccc(Cl)cc3Cl)cc2Br)cc1 |
| InChI | InChI=1S/C17H12BrCl2N5O2S/c18-14-9-24(8-10-1-2-11(19)7-15(10)20)23-16(14)22-17(28)21-12-3-5-13(6-4-12)25(26)27/h1-7,9H,8H2,(H2,21,22,23,28) |
| InChIKey | RBRLOYGJEMNDTO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.19 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|