C15H11ClFN3O2S3 — CID 21008700
1-(3-chloro-4-fluorophenyl)-3-(6-methylsulfonyl-1,3-benzothiazol-2-yl)thiourea (PubChem CID 21008700) has the molecular formula C15H11ClFN3O2S3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(6-methylsulfonyl-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(6-methylsulfonyl-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 21008700 |
| Molecular Formula | C15H11ClFN3O2S3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(6-methylsulfonyl-1,3-benzothiazol-2-yl)thiourea |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=S)Nc3ccc(F)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C15H11ClFN3O2S3/c1-25(21,22)9-3-5-12-13(7-9)24-15(19-12)20-14(23)18-8-2-4-11(17)10(16)6-8/h2-7H,1H3,(H2,18,19,20,23) |
| InChIKey | HOVKRVTXPXHREA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|