C15H11FN2O4S2 — CID 57422910
(4-fluorophenyl) N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamate (PubChem CID 57422910) has the molecular formula C15H11FN2O4S2 and a molecular weight of 366.40 g/mol. Its IUPAC name is (4-fluorophenyl) N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | (4-fluorophenyl) N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 57422910 |
| Molecular Formula | C15H11FN2O4S2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | (4-fluorophenyl) N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)Oc3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C15H11FN2O4S2/c1-24(20,21)11-6-7-12-13(8-11)23-14(17-12)18-15(19)22-10-4-2-9(16)3-5-10/h2-8H,1H3,(H,17,18,19) |
| InChIKey | FKOIDZRWNHQDAV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |