C17H8F16N2O3S2 — CID 4586517
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)nonanamide (PubChem CID 4586517) has the molecular formula C17H8F16N2O3S2 and a molecular weight of 656.36 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)nonanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)nonanamide |
|---|---|
| PubChem CID | 4586517 |
| Molecular Formula | C17H8F16N2O3S2 |
| Molecular Weight | 656.36 g/mol |
| Exact Mass | 655.97 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)nonanamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)sc2c1 |
| InChI | InChI=1S/C17H8F16N2O3S2/c1-40(37,38)5-2-3-6-7(4-5)39-10(34-6)35-9(36)12(22,23)14(26,27)16(30,31)17(32,33)15(28,29)13(24,25)11(20,21)8(18)19/h2-4,8H,1H3,(H,34,35,36) |
| InChIKey | KEPPLAKPIKVRCC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.36 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|