C11H10F2N4OS — CID 107641297
5-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,4-difluorobenzamide (PubChem CID 107641297) has the molecular formula C11H10F2N4OS and a molecular weight of 284.29 g/mol. Its IUPAC name is 5-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,4-difluorobenzamide.
| Compound Name | 5-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 107641297 |
| Molecular Formula | C11H10F2N4OS |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,4-difluorobenzamide |
| SMILES | CCc1nnc(NC(=O)c2cc(N)c(F)cc2F)s1 |
| InChI | InChI=1S/C11H10F2N4OS/c1-2-9-16-17-11(19-9)15-10(18)5-3-8(14)7(13)4-6(5)12/h3-4H,2,14H2,1H3,(H,15,17,18) |
| InChIKey | NXNFANJVLDEQLQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|