C12H10Cl2IN3OS — CID 24506394
3,5-dichloro-2-iodo-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 24506394) has the molecular formula C12H10Cl2IN3OS and a molecular weight of 442.11 g/mol. Its IUPAC name is 3,5-dichloro-2-iodo-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3,5-dichloro-2-iodo-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 24506394 |
| Molecular Formula | C12H10Cl2IN3OS |
| Molecular Weight | 442.11 g/mol |
| Exact Mass | 440.90 |
| IUPAC Name | 3,5-dichloro-2-iodo-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CC(C)c1nnc(NC(=O)c2cc(Cl)cc(Cl)c2I)s1 |
| InChI | InChI=1S/C12H10Cl2IN3OS/c1-5(2)11-17-18-12(20-11)16-10(19)7-3-6(13)4-8(14)9(7)15/h3-5H,1-2H3,(H,16,18,19) |
| InChIKey | DNSZGESQFXQESA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.11 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|