C16H12BrNO2S — CID 61033577
2-(1,3-benzothiazol-2-yl)-1-(3-bromo-4-methoxyphenyl)ethanone (PubChem CID 61033577) has the molecular formula C16H12BrNO2S and a molecular weight of 362.25 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(3-bromo-4-methoxyphenyl)ethanone.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(3-bromo-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 61033577 |
| Molecular Formula | C16H12BrNO2S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(3-bromo-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2nc3ccccc3s2)cc1Br |
| InChI | InChI=1S/C16H12BrNO2S/c1-20-14-7-6-10(8-11(14)17)13(19)9-16-18-12-4-2-3-5-15(12)21-16/h2-8H,9H2,1H3 |
| InChIKey | JITJBOKAWHWMQQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |