C14H9BrCl2O3 — CID 7875213
(3,4-dichlorophenyl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 7875213) has the molecular formula C14H9BrCl2O3 and a molecular weight of 376.03 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | (3,4-dichlorophenyl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7875213 |
| Molecular Formula | C14H9BrCl2O3 |
| Molecular Weight | 376.03 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | (3,4-dichlorophenyl)methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)o1)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9BrCl2O3/c15-13-5-2-10(20-13)3-6-14(18)19-8-9-1-4-11(16)12(17)7-9/h1-7H,8H2/b6-3+ |
| InChIKey | NMKCMHJMZWHPQU-ZZXKWVIFSA-N |
| XLogP | 5.11 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.03 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|