C17H11Cl2NO3 — CID 30129372
(3,4-dichlorophenyl)methyl (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate (PubChem CID 30129372) has the molecular formula C17H11Cl2NO3 and a molecular weight of 348.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate.
| Compound Name | (3,4-dichlorophenyl)methyl (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 30129372 |
| Molecular Formula | C17H11Cl2NO3 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (3,4-dichlorophenyl)methyl (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl2NO3/c18-12-6-5-11(9-13(12)19)10-22-17(21)8-7-16-20-14-3-1-2-4-15(14)23-16/h1-9H,10H2/b8-7+ |
| InChIKey | IMHUZFQTTCUEJR-BQYQJAHWSA-N |
| XLogP | 4.89 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|