C17H8F5NO3 — CID 18275026
(2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate (PubChem CID 18275026) has the molecular formula C17H8F5NO3 and a molecular weight of 369.25 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 18275026 |
| Molecular Formula | C17H8F5NO3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (E)-3-(1,3-benzoxazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H8F5NO3/c18-13-8(14(19)16(21)17(22)15(13)20)7-25-12(24)6-5-11-23-9-3-1-2-4-10(9)26-11/h1-6H,7H2/b6-5+ |
| InChIKey | MRPJBZQNHGUWBG-AATRIKPKSA-N |
| XLogP | 4.28 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|