C19H17BrN2O3 — CID 8933026
[4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 8933026) has the molecular formula C19H17BrN2O3 and a molecular weight of 401.26 g/mol. Its IUPAC name is [4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8933026 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | Cc1cc(C)n(-c2ccc(COC(=O)/C=C/c3ccc(Br)o3)cc2)n1 |
| InChI | InChI=1S/C19H17BrN2O3/c1-13-11-14(2)22(21-13)16-5-3-15(4-6-16)12-24-19(23)10-8-17-7-9-18(20)25-17/h3-11H,12H2,1-2H3/b10-8+ |
| InChIKey | DZYCLRLLMQAINM-CSKARUKUSA-N |
| XLogP | 4.60 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|