C16H10BrN3O6 — CID 6212241
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 6212241) has the molecular formula C16H10BrN3O6 and a molecular weight of 420.18 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6212241 |
| Molecular Formula | C16H10BrN3O6 |
| Molecular Weight | 420.18 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)o1)OCc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C16H10BrN3O6/c17-13-7-5-12(25-13)6-8-15(21)24-9-14-18-19-16(26-14)10-1-3-11(4-2-10)20(22)23/h1-8H,9H2/b8-6+ |
| InChIKey | NVFPUTNVFZMVLP-SOFGYWHQSA-N |
| XLogP | 3.76 |
| TPSA | 121.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|