C16H11ClN2O4 — CID 2469443
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 2469443) has the molecular formula C16H11ClN2O4 and a molecular weight of 330.73 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2469443 |
| Molecular Formula | C16H11ClN2O4 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccco1)OCc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C16H11ClN2O4/c17-12-5-3-11(4-6-12)16-19-18-14(23-16)10-22-15(20)8-7-13-2-1-9-21-13/h1-9H,10H2/b8-7+ |
| InChIKey | CJLFDFPPPPPNGR-BQYQJAHWSA-N |
| XLogP | 3.74 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|