C22H15ClN2O4 — CID 155813072
(E)-1-[4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 155813072) has the molecular formula C22H15ClN2O4 and a molecular weight of 406.83 g/mol. Its IUPAC name is (E)-1-[4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 155813072 |
| Molecular Formula | C22H15ClN2O4 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | (E)-1-[4-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccco1)c1ccc(OCc2nnc(-c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C22H15ClN2O4/c23-17-7-3-16(4-8-17)22-25-24-21(29-22)14-28-19-9-5-15(6-10-19)20(26)12-11-18-2-1-13-27-18/h1-13H,14H2/b12-11+ |
| InChIKey | XMFLZSMIPYYTAL-VAWYXSNFSA-N |
| XLogP | 5.46 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|