C18H13Cl2NO3 — CID 41218908
(3,4-dichlorophenyl)methyl (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate (PubChem CID 41218908) has the molecular formula C18H13Cl2NO3 and a molecular weight of 362.21 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate.
| Compound Name | (3,4-dichlorophenyl)methyl (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 41218908 |
| Molecular Formula | C18H13Cl2NO3 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (3,4-dichlorophenyl)methyl (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
| SMILES | N#CCOc1ccc(/C=C/C(=O)OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H13Cl2NO3/c19-16-7-3-14(11-17(16)20)12-24-18(22)8-4-13-1-5-15(6-2-13)23-10-9-21/h1-8,11H,10,12H2/b8-4+ |
| InChIKey | RIKLBBSJFNVRPZ-XBXARRHUSA-N |
| XLogP | 4.65 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|