C6H7Br2ClN2 — CID 133055680
(3,5-dibromo-2-pyridinyl)methanamine;hydrochloride (PubChem CID 133055680) has the molecular formula C6H7Br2ClN2 and a molecular weight of 302.40 g/mol. Its IUPAC name is (3,5-dibromo-2-pyridinyl)methanamine;hydrochloride.
| Compound Name | (3,5-dibromo-2-pyridinyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 133055680 |
| Molecular Formula | C6H7Br2ClN2 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 299.87 |
| IUPAC Name | (3,5-dibromo-2-pyridinyl)methanamine;hydrochloride |
| SMILES | Cl.NCc1ncc(Br)cc1Br |
| InChI | InChI=1S/C6H6Br2N2.ClH/c7-4-1-5(8)6(2-9)10-3-4;/h1,3H,2,9H2;1H |
| InChIKey | AYFPFQZRMNNOHV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |